C34H22N4 — CID 177070633
2,5-bis[3-(trideuteriomethyl)carbazol-9-yl]benzene-1,4-dicarbonitrile (PubChem CID 177070633) has the molecular formula C34H22N4 and a molecular weight of 492.61 g/mol. Its IUPAC name is 2,5-bis[3-(trideuteriomethyl)carbazol-9-yl]benzene-1,4-dicarbonitrile.
| Compound Name | 2,5-bis[3-(trideuteriomethyl)carbazol-9-yl]benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 177070633 |
| Molecular Formula | C34H22N4 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 2,5-bis[3-(trideuteriomethyl)carbazol-9-yl]benzene-1,4-dicarbonitrile |
| SMILES | [2H]C([2H])([2H])c1ccc2c(c1)c1ccccc1n2-c1cc(C#N)c(-n2c3ccccc3c3cc(C([2H])([2H])[2H])ccc32)cc1C#N |
| InChI | InChI=1S/C34H22N4/c1-21-11-13-31-27(15-21)25-7-3-5-9-29(25)37(31)33-17-24(20-36)34(18-23(33)19-35)38-30-10-6-4-8-26(30)28-16-22(2)12-14-32(28)38/h3-18H,1-2H3/i1D3,2D3 |
| InChIKey | WLOVVSOVSVXPGZ-WFGJKAKNSA-N |
| XLogP | 8.24 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |