About 1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane
1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane (PubChem CID 177071314) has the molecular formula C14H20N2
and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane.
Molecular Properties
| Compound Name | 1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane |
| PubChem CID | 177071314 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane |
| SMILES | CC(C)N1CC2(CCN2c2ccccc2)C1 |
| InChI | InChI=1S/C14H20N2/c1-12(2)15-10-14(11-15)8-9-16(14)13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3 |
| InChIKey | XSDCODQIOXLVAW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane?
The IUPAC name of 1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane (CID 177071314) is 1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane.
What is the SMILES notation for 1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane?
The canonical SMILES for 1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane is CC(C)N1CC2(CCN2c2ccccc2)C1.
What is the InChIKey of 1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane?
The InChIKey is XSDCODQIOXLVAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2/c1-12(2)15-10-14(11-15)8-9-16(14)13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3.
What are the key properties of 1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane?
1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane has a molecular weight of 216.33 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-6-propan-2-yl-1,6-diazaspiro[3.3]heptane is sourced from PubChem (CID 177071314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).