C40H24S — CID 177072017
8-(4-benzo[a]anthracen-10-yl-2,3,5,6-tetradeuteriophenyl)naphtho[1,2-b][1]benzothiole (PubChem CID 177072017) has the molecular formula C40H24S and a molecular weight of 540.72 g/mol. Its IUPAC name is 8-(4-benzo[a]anthracen-10-yl-2,3,5,6-tetradeuteriophenyl)naphtho[1,2-b][1]benzothiole.
| Compound Name | 8-(4-benzo[a]anthracen-10-yl-2,3,5,6-tetradeuteriophenyl)naphtho[1,2-b][1]benzothiole |
|---|---|
| PubChem CID | 177072017 |
| Molecular Formula | C40H24S |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 8-(4-benzo[a]anthracen-10-yl-2,3,5,6-tetradeuteriophenyl)naphtho[1,2-b][1]benzothiole |
| SMILES | [2H]c1c([2H])c(-c2ccc3sc4c5ccccc5ccc4c3c2)c([2H])c([2H])c1-c1ccc2cc3ccc4ccccc4c3cc2c1 |
| InChI | InChI=1S/C40H24S/c1-3-7-34-27(5-1)13-16-32-21-30-15-14-29(22-33(30)24-37(32)34)25-9-11-26(12-10-25)31-18-20-39-38(23-31)36-19-17-28-6-2-4-8-35(28)40(36)41-39/h1-24H/i9D,10D,11D,12D |
| InChIKey | GFTOSKYFOZOESL-IRYCTXJYSA-N |
| XLogP | 12.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|