C40H53FGeIrNO2- — CID 177073365
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;[3-[6-(2,2-dimethylpropyl)-4-fluoroisoquinolin-1-yl]-4H-naphthalen-4-id-1-yl]-trimethylgermane;iridium (PubChem CID 177073365) has the molecular formula C40H53FGeIrNO2- and a molecular weight of 863.69 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;[3-[6-(2,2-dimethylpropyl)-4-fluoroisoquinolin-1-yl]-4H-naphthalen-4-id-1-yl]-trimethylgermane;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;[3-[6-(2,2-dimethylpropyl)-4-fluoroisoquinolin-1-yl]-4H-naphthalen-4-id-1-yl]-trimethylgermane;iridium |
|---|---|
| PubChem CID | 177073365 |
| Molecular Formula | C40H53FGeIrNO2- |
| Molecular Weight | 863.69 g/mol |
| Exact Mass | 865.29 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;[3-[6-(2,2-dimethylpropyl)-4-fluoroisoquinolin-1-yl]-4H-naphthalen-4-id-1-yl]-trimethylgermane;iridium |
| SMILES | CC(C)(C)Cc1ccc2c(-c3[c-]c4ccccc4c([Ge](C)(C)C)c3)ncc(F)c2c1.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C27H29FGeN.C13H24O2.Ir/c1-27(2,3)16-18-11-12-22-23(13-18)24(28)17-30-26(22)20-14-19-9-7-8-10-21(19)25(15-20)29(4,5)6;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h7-13,15,17H,16H2,1-6H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | ADHXSUIIQWJDRE-DZTQYQPZSA-N |
| XLogP | 11.00 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.69 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|