About CID 177073419
CID 177073419 (PubChem CID 177073419) has the molecular formula C54H47F3N5OPt-
and a molecular weight of 1034.08 g/mol.
Molecular Properties
| Compound Name | CID 177073419 |
| PubChem CID | 177073419 |
| Molecular Formula | C54H47F3N5OPt- |
| Molecular Weight | 1034.08 g/mol |
| Exact Mass | 1033.34 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-n2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)nc3c(-c4[c-]c5c6ncc(C(F)(F)F)c7ccc8nc(C)n(c5c(C)c4)c8c76)cccc32)c(-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C54H47F3N5O.Pt/c1-28-21-29(2)47(37(22-28)32-15-12-11-13-16-32)62-43-18-14-17-35(45(43)60-51(62)39-25-34(52(5,6)7)26-40(50(39)63)53(8,9)10)33-23-30(3)48-38(24-33)46-44-36(41(27-58-46)54(55,56)57)19-20-42-49(44)61(48)31(4)59-42;/h11-23,25-27,63H,1-10H3;/q-1; |
| InChIKey | RDDBPKFOGRGEQR-UHFFFAOYSA-N |
| XLogP | 14.32 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1034.08 |
| LogP ≤ 5 | 14.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 177073419 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177073419?
The IUPAC name of CID 177073419 (CID 177073419) is not available.
What is the SMILES notation for CID 177073419?
The canonical SMILES for CID 177073419 is Cc1cc(C)c(-n2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)nc3c(-c4[c-]c5c6ncc(C(F)(F)F)c7ccc8nc(C)n(c5c(C)c4)c8c76)cccc32)c(-c2ccccc2)c1.[Pt].
What is the InChIKey of CID 177073419?
The InChIKey is RDDBPKFOGRGEQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C54H47F3N5O.Pt/c1-28-21-29(2)47(37(22-28)32-15-12-11-13-16-32)62-43-18-14-17-35(45(43)60-51(62)39-25-34(52(5,6)7)26-40(50(39)63)53(8,9)10)33-23-30(3)48-38(24-33)46-44-36(41(27-58-46)54(55,56)57)19-20-42-49(44)61(48)31(4)59-42;/h11-23,25-27,63H,1-10H3;/q-1;.
What are the key properties of CID 177073419?
CID 177073419 has a molecular weight of 1034.08 g/mol, XLogP of 14.32, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177073419 is sourced from PubChem (CID 177073419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).