C24H44NO9PS2 — CID 177075179
[3-[2-[[2-(dithiolan-3-yl)acetyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-heptanoyloxypropyl] heptanoate (PubChem CID 177075179) has the molecular formula C24H44NO9PS2 and a molecular weight of 585.72 g/mol. Its IUPAC name is [3-[2-[[2-(dithiolan-3-yl)acetyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-heptanoyloxypropyl] heptanoate.
| Compound Name | [3-[2-[[2-(dithiolan-3-yl)acetyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-heptanoyloxypropyl] heptanoate |
|---|---|
| PubChem CID | 177075179 |
| Molecular Formula | C24H44NO9PS2 |
| Molecular Weight | 585.72 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | [3-[2-[[2-(dithiolan-3-yl)acetyl]amino]ethoxy-hydroxyphosphoryl]oxy-2-heptanoyloxypropyl] heptanoate |
| SMILES | CCCCCCC(=O)OCC(COP(=O)(O)OCCNC(=O)CC1CCSS1)OC(=O)CCCCCC |
| InChI | InChI=1S/C24H44NO9PS2/c1-3-5-7-9-11-23(27)31-18-20(34-24(28)12-10-8-6-4-2)19-33-35(29,30)32-15-14-25-22(26)17-21-13-16-36-37-21/h20-21H,3-19H2,1-2H3,(H,25,26)(H,29,30) |
| InChIKey | GRCSPKUGDCVFRE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.72 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|