C8H10N2O5 — CID 177077743
3-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-1H-pyrimidine-2,4-dione (PubChem CID 177077743) has the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. Its IUPAC name is 3-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 177077743 |
| Molecular Formula | C8H10N2O5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc[nH]c(=O)n1[C@@H]1OC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H10N2O5/c11-4-3-15-7(6(4)13)10-5(12)1-2-9-8(10)14/h1-2,4,6-7,11,13H,3H2,(H,9,14)/t4-,6+,7+/m0/s1 |
| InChIKey | SXDOSTFGFIIONW-UBKIQSJTSA-N |
| XLogP | -2.21 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |