C21H17BrN4O2 — CID 177077881
2-[5-bromo-4-(1,3-dihydroisoindol-2-yl)-1-(5-methyl-3-pyridinyl)-2,6-dioxo-3H-pyridin-3-yl]acetonitrile (PubChem CID 177077881) has the molecular formula C21H17BrN4O2 and a molecular weight of 437.30 g/mol. Its IUPAC name is 2-[5-bromo-4-(1,3-dihydroisoindol-2-yl)-1-(5-methyl-3-pyridinyl)-2,6-dioxo-3H-pyridin-3-yl]acetonitrile.
| Compound Name | 2-[5-bromo-4-(1,3-dihydroisoindol-2-yl)-1-(5-methyl-3-pyridinyl)-2,6-dioxo-3H-pyridin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 177077881 |
| Molecular Formula | C21H17BrN4O2 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2-[5-bromo-4-(1,3-dihydroisoindol-2-yl)-1-(5-methyl-3-pyridinyl)-2,6-dioxo-3H-pyridin-3-yl]acetonitrile |
| SMILES | Cc1cncc(N2C(=O)C(Br)=C(N3Cc4ccccc4C3)C(CC#N)C2=O)c1 |
| InChI | InChI=1S/C21H17BrN4O2/c1-13-8-16(10-24-9-13)26-20(27)17(6-7-23)19(18(22)21(26)28)25-11-14-4-2-3-5-15(14)12-25/h2-5,8-10,17H,6,11-12H2,1H3 |
| InChIKey | WZTOLECYPJOOLB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|