C8H17F2NO — CID 177078690
(2R)-2-(tert-butylamino)-4,4-difluorobutan-1-ol (PubChem CID 177078690) has the molecular formula C8H17F2NO and a molecular weight of 181.23 g/mol. Its IUPAC name is (2R)-2-(tert-butylamino)-4,4-difluorobutan-1-ol.
| Compound Name | (2R)-2-(tert-butylamino)-4,4-difluorobutan-1-ol |
|---|---|
| PubChem CID | 177078690 |
| Molecular Formula | C8H17F2NO |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (2R)-2-(tert-butylamino)-4,4-difluorobutan-1-ol |
| SMILES | CC(C)(C)N[C@@H](CO)CC(F)F |
| InChI | InChI=1S/C8H17F2NO/c1-8(2,3)11-6(5-12)4-7(9)10/h6-7,11-12H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | YJTDWRJWJVUSMH-ZCFIWIBFSA-N |
| XLogP | 1.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |