C8H16F3NO — CID 177078733
(2R)-2-(tert-butylamino)-4,4,4-trifluorobutan-1-ol (PubChem CID 177078733) has the molecular formula C8H16F3NO and a molecular weight of 199.22 g/mol. Its IUPAC name is (2R)-2-(tert-butylamino)-4,4,4-trifluorobutan-1-ol.
| Compound Name | (2R)-2-(tert-butylamino)-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 177078733 |
| Molecular Formula | C8H16F3NO |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (2R)-2-(tert-butylamino)-4,4,4-trifluorobutan-1-ol |
| SMILES | CC(C)(C)N[C@@H](CO)CC(F)(F)F |
| InChI | InChI=1S/C8H16F3NO/c1-7(2,3)12-6(5-13)4-8(9,10)11/h6,12-13H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | MQCNTEYQNLDJLD-ZCFIWIBFSA-N |
| XLogP | 1.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |