About 4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol
4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol (PubChem CID 177078796) has the molecular formula C10H10FNO2
and a molecular weight of 195.19 g/mol. Its IUPAC name is 4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol.
Molecular Properties
| Compound Name | 4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol |
| PubChem CID | 177078796 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol |
| SMILES | CC(C)c1cc2ocnc2c(F)c1O |
| InChI | InChI=1S/C10H10FNO2/c1-5(2)6-3-7-9(12-4-14-7)8(11)10(6)13/h3-5,13H,1-2H3 |
| InChIKey | UOQYJSVCIUICOA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol?
The IUPAC name of 4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol (CID 177078796) is 4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol.
What is the SMILES notation for 4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol?
The canonical SMILES for 4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol is CC(C)c1cc2ocnc2c(F)c1O.
What is the InChIKey of 4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol?
The InChIKey is UOQYJSVCIUICOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO2/c1-5(2)6-3-7-9(12-4-14-7)8(11)10(6)13/h3-5,13H,1-2H3.
What are the key properties of 4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol?
4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol has a molecular weight of 195.19 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-6-propan-2-yl-1,3-benzoxazol-5-ol is sourced from PubChem (CID 177078796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).