C63H42N4 — CID 177079103
3-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,5-diphenylphenyl]-9-phenylcarbazole (PubChem CID 177079103) has the molecular formula C63H42N4 and a molecular weight of 855.06 g/mol. Its IUPAC name is 3-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,5-diphenylphenyl]-9-phenylcarbazole.
| Compound Name | 3-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,5-diphenylphenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 177079103 |
| Molecular Formula | C63H42N4 |
| Molecular Weight | 855.06 g/mol |
| Exact Mass | 854.34 |
| IUPAC Name | 3-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,5-diphenylphenyl]-9-phenylcarbazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cc(-c5ccccc5)cc(-c5ccc6c(c5)c5ccccc5n6-c5ccccc5)c4-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C63H42N4/c1-6-18-43(19-7-1)46-30-34-49(35-31-46)61-64-62(50-36-32-47(33-37-50)44-20-8-2-9-21-44)66-63(65-61)57-42-52(45-22-10-3-11-23-45)41-55(60(57)48-24-12-4-13-25-48)51-38-39-59-56(40-51)54-28-16-17-29-58(54)67(59)53-26-14-5-15-27-53/h1-42H |
| InChIKey | OMTPLZTUCIOSHC-UHFFFAOYSA-N |
| XLogP | 16.30 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.06 |
| LogP ≤ 5 | 16.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |