C60H43N3 — CID 177079134
2-[4-[3-[3-(9,9-dimethylfluoren-3-yl)-2,5-diphenylphenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 177079134) has the molecular formula C60H43N3 and a molecular weight of 806.03 g/mol. Its IUPAC name is 2-[4-[3-[3-(9,9-dimethylfluoren-3-yl)-2,5-diphenylphenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[3-[3-(9,9-dimethylfluoren-3-yl)-2,5-diphenylphenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 177079134 |
| Molecular Formula | C60H43N3 |
| Molecular Weight | 806.03 g/mol |
| Exact Mass | 805.35 |
| IUPAC Name | 2-[4-[3-[3-(9,9-dimethylfluoren-3-yl)-2,5-diphenylphenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3cc(-c4ccccc4)cc(-c4cccc(-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5)c4)c3-c3ccccc3)ccc21 |
| InChI | InChI=1S/C60H43N3/c1-60(2)54-29-16-15-28-50(54)53-37-48(34-35-55(53)60)52-39-49(40-18-7-3-8-19-40)38-51(56(52)42-20-9-4-10-21-42)47-27-17-26-46(36-47)41-30-32-45(33-31-41)59-62-57(43-22-11-5-12-23-43)61-58(63-59)44-24-13-6-14-25-44/h3-39H,1-2H3 |
| InChIKey | ADCWNCSSXUBPNV-UHFFFAOYSA-N |
| XLogP | 15.51 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.03 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |