C69H47N3OSi — CID 177079309
[3-[3-[4-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-2,5-diphenylphenyl]phenyl]-triphenylsilane (PubChem CID 177079309) has the molecular formula C69H47N3OSi and a molecular weight of 962.24 g/mol. Its IUPAC name is [3-[3-[4-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-2,5-diphenylphenyl]phenyl]-triphenylsilane.
| Compound Name | [3-[3-[4-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-2,5-diphenylphenyl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 177079309 |
| Molecular Formula | C69H47N3OSi |
| Molecular Weight | 962.24 g/mol |
| Exact Mass | 961.35 |
| IUPAC Name | [3-[3-[4-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-2,5-diphenylphenyl]phenyl]-triphenylsilane |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccc6c(c5)oc5ccccc56)n4)cc3)c(-c3ccccc3)c(-c3cccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)c3)c2)cc1 |
| InChI | InChI=1S/C69H47N3OSi/c1-7-22-48(23-8-1)55-45-62(49-38-40-52(41-39-49)68-70-67(51-26-11-3-12-27-51)71-69(72-68)54-42-43-61-60-36-19-20-37-64(60)73-65(61)47-54)66(50-24-9-2-10-25-50)63(46-55)53-28-21-35-59(44-53)74(56-29-13-4-14-30-56,57-31-15-5-16-32-57)58-33-17-6-18-34-58/h1-47H |
| InChIKey | GNFJEHUXRFBTPD-UHFFFAOYSA-N |
| XLogP | 14.82 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.24 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|