C38H20N2O4S2 — CID 177079593
5-[2-(1,3-dioxo-2-phenylisoindol-5-yl)thieno[2,3-f][1]benzothiol-6-yl]-2-phenylisoindole-1,3-dione (PubChem CID 177079593) has the molecular formula C38H20N2O4S2 and a molecular weight of 632.72 g/mol. Its IUPAC name is 5-[2-(1,3-dioxo-2-phenylisoindol-5-yl)thieno[2,3-f][1]benzothiol-6-yl]-2-phenylisoindole-1,3-dione.
| Compound Name | 5-[2-(1,3-dioxo-2-phenylisoindol-5-yl)thieno[2,3-f][1]benzothiol-6-yl]-2-phenylisoindole-1,3-dione |
|---|---|
| PubChem CID | 177079593 |
| Molecular Formula | C38H20N2O4S2 |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.09 |
| IUPAC Name | 5-[2-(1,3-dioxo-2-phenylisoindol-5-yl)thieno[2,3-f][1]benzothiol-6-yl]-2-phenylisoindole-1,3-dione |
| SMILES | O=C1c2ccc(-c3cc4cc5sc(-c6ccc7c(c6)C(=O)N(c6ccccc6)C7=O)cc5cc4s3)cc2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C38H20N2O4S2/c41-35-27-13-11-21(15-29(27)37(43)39(35)25-7-3-1-4-8-25)31-17-23-19-34-24(20-33(23)45-31)18-32(46-34)22-12-14-28-30(16-22)38(44)40(36(28)42)26-9-5-2-6-10-26/h1-20H |
| InChIKey | NFDIOROCJSQUHX-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|