C28H40N5O7P — CID 177083801
2-ethylbutyl (2S)-2-[[benzyl-[2-[[4-(2,4-dimethoxypyrimidin-5-yl)imidazol-1-yl]methoxy]ethoxy]phosphoryl]amino]propanoate (PubChem CID 177083801) has the molecular formula C28H40N5O7P and a molecular weight of 589.63 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[benzyl-[2-[[4-(2,4-dimethoxypyrimidin-5-yl)imidazol-1-yl]methoxy]ethoxy]phosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[benzyl-[2-[[4-(2,4-dimethoxypyrimidin-5-yl)imidazol-1-yl]methoxy]ethoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 177083801 |
| Molecular Formula | C28H40N5O7P |
| Molecular Weight | 589.63 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[benzyl-[2-[[4-(2,4-dimethoxypyrimidin-5-yl)imidazol-1-yl]methoxy]ethoxy]phosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)NP(=O)(Cc1ccccc1)OCCOCn1cnc(-c2cnc(OC)nc2OC)c1 |
| InChI | InChI=1S/C28H40N5O7P/c1-6-22(7-2)17-39-27(34)21(3)32-41(35,18-23-11-9-8-10-12-23)40-14-13-38-20-33-16-25(30-19-33)24-15-29-28(37-5)31-26(24)36-4/h8-12,15-16,19,21-22H,6-7,13-14,17-18,20H2,1-5H3,(H,32,35)/t21-,41?/m0/s1 |
| InChIKey | QGCMSALQTSDBFA-ZJFDOAQXSA-N |
| XLogP | 4.70 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|