About 2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene]
2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene] (PubChem CID 177084529) has the molecular formula C15H10BrClO2
and a molecular weight of 337.60 g/mol. Its IUPAC name is 2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene].
Molecular Properties
| Compound Name | 2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene] |
| PubChem CID | 177084529 |
| Molecular Formula | C15H10BrClO2 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene] |
| SMILES | Clc1cc(Br)cc2c1-c1ccccc1C21OCCO1 |
| InChI | InChI=1S/C15H10BrClO2/c16-9-7-12-14(13(17)8-9)10-3-1-2-4-11(10)15(12)18-5-6-19-15/h1-4,7-8H,5-6H2 |
| InChIKey | JPRIWCJKIDZSPY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene]?
The IUPAC name of 2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene] (CID 177084529) is 2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene].
What is the SMILES notation for 2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene]?
The canonical SMILES for 2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene] is Clc1cc(Br)cc2c1-c1ccccc1C21OCCO1.
What is the InChIKey of 2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene]?
The InChIKey is JPRIWCJKIDZSPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrClO2/c16-9-7-12-14(13(17)8-9)10-3-1-2-4-11(10)15(12)18-5-6-19-15/h1-4,7-8H,5-6H2.
What are the key properties of 2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene]?
2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene] has a molecular weight of 337.60 g/mol, XLogP of 4.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-bromo-4'-chlorospiro[1,3-dioxolane-2,9'-fluorene] is sourced from PubChem (CID 177084529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).