C32H22O3 — CID 177084617
5-hexadeca-1,3,5,7,9,11,13,15-octaynyl-2-(5-hydroxy-5-methyl-2-prop-1-en-2-ylcyclohexyl)benzene-1,3-diol (PubChem CID 177084617) has the molecular formula C32H22O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 5-hexadeca-1,3,5,7,9,11,13,15-octaynyl-2-(5-hydroxy-5-methyl-2-prop-1-en-2-ylcyclohexyl)benzene-1,3-diol.
| Compound Name | 5-hexadeca-1,3,5,7,9,11,13,15-octaynyl-2-(5-hydroxy-5-methyl-2-prop-1-en-2-ylcyclohexyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 177084617 |
| Molecular Formula | C32H22O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 5-hexadeca-1,3,5,7,9,11,13,15-octaynyl-2-(5-hydroxy-5-methyl-2-prop-1-en-2-ylcyclohexyl)benzene-1,3-diol |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#Cc1cc(O)c(C2CC(C)(O)CCC2C(=C)C)c(O)c1 |
| InChI | InChI=1S/C32H22O3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26-22-29(33)31(30(34)23-26)28-24-32(4,35)21-20-27(28)25(2)3/h1,22-23,27-28,33-35H,2,20-21,24H2,3-4H3 |
| InChIKey | FYDXUZFJFHTIDR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|