C20H13Cl2F3N4O — CID 177084635
7-benzyl-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-isocyano-4,6-dihydropyrazolo[5,4-d][1,3]oxazine (PubChem CID 177084635) has the molecular formula C20H13Cl2F3N4O and a molecular weight of 453.25 g/mol. Its IUPAC name is 7-benzyl-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-isocyano-4,6-dihydropyrazolo[5,4-d][1,3]oxazine.
| Compound Name | 7-benzyl-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-isocyano-4,6-dihydropyrazolo[5,4-d][1,3]oxazine |
|---|---|
| PubChem CID | 177084635 |
| Molecular Formula | C20H13Cl2F3N4O |
| Molecular Weight | 453.25 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 7-benzyl-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-isocyano-4,6-dihydropyrazolo[5,4-d][1,3]oxazine |
| SMILES | [C-]#[N+]c1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c2c1COCN2Cc1ccccc1 |
| InChI | InChI=1S/C20H13Cl2F3N4O/c1-26-18-14-10-30-11-28(9-12-5-3-2-4-6-12)19(14)29(27-18)17-15(21)7-13(8-16(17)22)20(23,24)25/h2-8H,9-11H2 |
| InChIKey | UNUCTQPPDOMANQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 34.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.25 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|