C40H47N5O4 — CID 177085110
3-[6-[4-[[1-[4-[(1S,2R)-6-hydroxy-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177085110) has the molecular formula C40H47N5O4 and a molecular weight of 661.85 g/mol. Its IUPAC name is 3-[6-[4-[[1-[4-[(1S,2R)-6-hydroxy-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[[1-[4-[(1S,2R)-6-hydroxy-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177085110 |
| Molecular Formula | C40H47N5O4 |
| Molecular Weight | 661.85 g/mol |
| Exact Mass | 661.36 |
| IUPAC Name | 3-[6-[4-[[1-[4-[(1S,2R)-6-hydroxy-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C[C@@H]1CCc2cc(O)ccc2[C@@H]1c1ccc(N2CCC(CN3CCN(c4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1 |
| InChI | InChI=1S/C40H47N5O4/c1-26-2-3-29-23-33(46)9-11-34(29)38(26)28-4-6-31(7-5-28)43-16-14-27(15-17-43)24-42-18-20-44(21-19-42)32-8-10-35-30(22-32)25-45(40(35)49)36-12-13-37(47)41-39(36)48/h4-11,22-23,26-27,36,38,46H,2-3,12-21,24-25H2,1H3,(H,41,47,48)/t26-,36?,38+/m1/s1 |
| InChIKey | GGDKVBKJSUCIAI-RINKYRBMSA-N |
| XLogP | 4.91 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.85 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|