C8H15F3N2O2 — CID 177087461
1-tert-butyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea (PubChem CID 177087461) has the molecular formula C8H15F3N2O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is 1-tert-butyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea.
| Compound Name | 1-tert-butyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea |
|---|---|
| PubChem CID | 177087461 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1-tert-butyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea |
| SMILES | CC(C)(C)NC(=O)NC(CO)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O2/c1-7(2,3)13-6(15)12-5(4-14)8(9,10)11/h5,14H,4H2,1-3H3,(H2,12,13,15) |
| InChIKey | FUOUFTWVNRCPGG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |