About N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide
N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide (PubChem CID 177087468) has the molecular formula C9H16F2N2O3
and a molecular weight of 238.23 g/mol. Its IUPAC name is N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide.
Molecular Properties
| Compound Name | N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide |
| PubChem CID | 177087468 |
| Molecular Formula | C9H16F2N2O3 |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide |
| SMILES | CC(C)(C)NC(=O)C(F)(F)C(=O)NCCO |
| InChI | InChI=1S/C9H16F2N2O3/c1-8(2,3)13-7(16)9(10,11)6(15)12-4-5-14/h14H,4-5H2,1-3H3,(H,12,15)(H,13,16) |
| InChIKey | OGFXZJRBWAZANQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide?
The IUPAC name of N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide (CID 177087468) is N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide.
What is the SMILES notation for N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide?
The canonical SMILES for N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide is CC(C)(C)NC(=O)C(F)(F)C(=O)NCCO.
What is the InChIKey of N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide?
The InChIKey is OGFXZJRBWAZANQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2N2O3/c1-8(2,3)13-7(16)9(10,11)6(15)12-4-5-14/h14H,4-5H2,1-3H3,(H,12,15)(H,13,16).
What are the key properties of N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide?
N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide has a molecular weight of 238.23 g/mol, XLogP of -0.36, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,2-difluoro-N'-(2-hydroxyethyl)propanediamide is sourced from PubChem (CID 177087468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).