C55H43N3OSi — CID 177088094
[1-[7-[3-[4-(1-benzofuran-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9,9-dimethylfluoren-2-yl]phenanthren-4-yl]-trimethylsilane (PubChem CID 177088094) has the molecular formula C55H43N3OSi and a molecular weight of 790.06 g/mol. Its IUPAC name is [1-[7-[3-[4-(1-benzofuran-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9,9-dimethylfluoren-2-yl]phenanthren-4-yl]-trimethylsilane.
| Compound Name | [1-[7-[3-[4-(1-benzofuran-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9,9-dimethylfluoren-2-yl]phenanthren-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 177088094 |
| Molecular Formula | C55H43N3OSi |
| Molecular Weight | 790.06 g/mol |
| Exact Mass | 789.32 |
| IUPAC Name | [1-[7-[3-[4-(1-benzofuran-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9,9-dimethylfluoren-2-yl]phenanthren-4-yl]-trimethylsilane |
| SMILES | CC1(C)c2cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5cc6ccccc6o5)n4)c3)ccc2-c2ccc(-c3ccc([Si](C)(C)C)c4c3ccc3ccccc34)cc21 |
| InChI | InChI=1S/C55H43N3OSi/c1-55(2)46-31-37(36-18-13-19-40(30-36)53-56-52(35-15-7-6-8-16-35)57-54(58-53)49-33-39-17-10-12-21-48(39)59-49)23-25-43(46)44-26-24-38(32-47(44)55)41-28-29-50(60(3,4)5)51-42-20-11-9-14-34(42)22-27-45(41)51/h6-33H,1-5H3 |
| InChIKey | BZYSDBJVSPSSIO-UHFFFAOYSA-N |
| XLogP | 14.11 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.06 |
| LogP ≤ 5 | 14.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|