C60H53N3Si — CID 177088161
[7-[3-[3-[2,6-bis(4-pyridin-3-ylphenyl)-4-pyridinyl]phenyl]phenyl]-9,9-dimethylfluoren-3-yl]-triethylsilane (PubChem CID 177088161) has the molecular formula C60H53N3Si and a molecular weight of 844.19 g/mol. Its IUPAC name is [7-[3-[3-[2,6-bis(4-pyridin-3-ylphenyl)-4-pyridinyl]phenyl]phenyl]-9,9-dimethylfluoren-3-yl]-triethylsilane.
| Compound Name | [7-[3-[3-[2,6-bis(4-pyridin-3-ylphenyl)-4-pyridinyl]phenyl]phenyl]-9,9-dimethylfluoren-3-yl]-triethylsilane |
|---|---|
| PubChem CID | 177088161 |
| Molecular Formula | C60H53N3Si |
| Molecular Weight | 844.19 g/mol |
| Exact Mass | 843.40 |
| IUPAC Name | [7-[3-[3-[2,6-bis(4-pyridin-3-ylphenyl)-4-pyridinyl]phenyl]phenyl]-9,9-dimethylfluoren-3-yl]-triethylsilane |
| SMILES | CC[Si](CC)(CC)c1ccc2c(c1)-c1ccc(-c3cccc(-c4cccc(-c5cc(-c6ccc(-c7cccnc7)cc6)nc(-c6ccc(-c7cccnc7)cc6)c5)c4)c3)cc1C2(C)C |
| InChI | InChI=1S/C60H53N3Si/c1-6-64(7-2,8-3)53-28-30-56-55(38-53)54-29-27-49(35-57(54)60(56,4)5)47-15-9-13-45(33-47)46-14-10-16-48(34-46)52-36-58(43-23-19-41(20-24-43)50-17-11-31-61-39-50)63-59(37-52)44-25-21-42(22-26-44)51-18-12-32-62-40-51/h9-40H,6-8H2,1-5H3 |
| InChIKey | KOPLNVLUHDZDAQ-UHFFFAOYSA-N |
| XLogP | 15.56 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.19 |
| LogP ≤ 5 | 15.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|