C27H34O8 — CID 177088528
methyl 9-(ethoxymethoxy)-6a,10b-dimethyl-4,10-dioxo-2-(2-prop-1-ynylfuran-3-yl)-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate (PubChem CID 177088528) has the molecular formula C27H34O8 and a molecular weight of 486.56 g/mol. Its IUPAC name is methyl 9-(ethoxymethoxy)-6a,10b-dimethyl-4,10-dioxo-2-(2-prop-1-ynylfuran-3-yl)-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate.
| Compound Name | methyl 9-(ethoxymethoxy)-6a,10b-dimethyl-4,10-dioxo-2-(2-prop-1-ynylfuran-3-yl)-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
|---|---|
| PubChem CID | 177088528 |
| Molecular Formula | C27H34O8 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | methyl 9-(ethoxymethoxy)-6a,10b-dimethyl-4,10-dioxo-2-(2-prop-1-ynylfuran-3-yl)-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
| SMILES | CC#Cc1occc1C1CC2(C)C(CCC3(C)C(C(=O)OC)CC(OCOCC)C(=O)C32)C(=O)O1 |
| InChI | InChI=1S/C27H34O8/c1-6-8-19-16(10-12-33-19)21-14-27(4)17(25(30)35-21)9-11-26(3)18(24(29)31-5)13-20(22(28)23(26)27)34-15-32-7-2/h10,12,17-18,20-21,23H,7,9,11,13-15H2,1-5H3 |
| InChIKey | YJXXRBDBHPEALB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|