C33H39O3S+ — CID 177088675
[(3Z,5Z)-4-methyl-5-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]hepta-1,3,5-trien-2-yl]-diphenylsulfanium (PubChem CID 177088675) has the molecular formula C33H39O3S+ and a molecular weight of 515.74 g/mol. Its IUPAC name is [(3Z,5Z)-4-methyl-5-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]hepta-1,3,5-trien-2-yl]-diphenylsulfanium.
| Compound Name | [(3Z,5Z)-4-methyl-5-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]hepta-1,3,5-trien-2-yl]-diphenylsulfanium |
|---|---|
| PubChem CID | 177088675 |
| Molecular Formula | C33H39O3S+ |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | [(3Z,5Z)-4-methyl-5-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]hepta-1,3,5-trien-2-yl]-diphenylsulfanium |
| SMILES | C=C(/C=C(C)\C(=C\C)OCC(=O)OC1(C)C2CC3CC(C2)CC1C3)[S+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H39O3S/c1-5-31(35-22-32(34)36-33(4)27-18-25-17-26(20-27)21-28(33)19-25)23(2)16-24(3)37(29-12-8-6-9-13-29)30-14-10-7-11-15-30/h5-16,25-28H,3,17-22H2,1-2,4H3/q+1/b23-16-,31-5- |
| InChIKey | PTVTYFOFPMGCMP-YRBTZPNGSA-N |
| XLogP | 7.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|