C46H26N4O2 — CID 177089796
3-[4-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-8-phenyl-7,18-dioxa-9-azapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),6(10),8,11(16),12,14-octaene (PubChem CID 177089796) has the molecular formula C46H26N4O2 and a molecular weight of 666.74 g/mol. Its IUPAC name is 3-[4-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-8-phenyl-7,18-dioxa-9-azapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),6(10),8,11(16),12,14-octaene.
| Compound Name | 3-[4-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-8-phenyl-7,18-dioxa-9-azapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),6(10),8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 177089796 |
| Molecular Formula | C46H26N4O2 |
| Molecular Weight | 666.74 g/mol |
| Exact Mass | 666.21 |
| IUPAC Name | 3-[4-(4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-8-phenyl-7,18-dioxa-9-azapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),6(10),8,11(16),12,14-octaene |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4cc5oc6cccc7c8nc(-c9ccccc9)oc8c(c4)c5c67)cc3)nc(-c3ccc4ccccc4c3)n2)cc1 |
| InChI | InChI=1S/C46H26N4O2/c1-3-11-29(12-4-1)43-48-44(50-45(49-43)33-23-20-27-10-7-8-15-32(27)24-33)30-21-18-28(19-22-30)34-25-36-40-38(26-34)51-37-17-9-16-35(39(37)40)41-42(36)52-46(47-41)31-13-5-2-6-14-31/h1-26H |
| InChIKey | HPSMEBJEECJNDY-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.74 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|