C25H44O4 — CID 177090832
(3S,5S,8R,9S,10S,13S,14S,17R)-17-(2-tert-butylperoxyethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 177090832) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is (3S,5S,8R,9S,10S,13S,14S,17R)-17-(2-tert-butylperoxyethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,8R,9S,10S,13S,14S,17R)-17-(2-tert-butylperoxyethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 177090832 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | (3S,5S,8R,9S,10S,13S,14S,17R)-17-(2-tert-butylperoxyethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)(C)OOCCO[C@@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H44O4/c1-23(2,3)29-28-15-14-27-22-9-8-20-19-7-6-17-16-18(26)10-12-24(17,4)21(19)11-13-25(20,22)5/h17-22,26H,6-16H2,1-5H3/t17-,18-,19-,20-,21-,22+,24-,25-/m0/s1 |
| InChIKey | DTDBJJOOVWRBLK-RADHVNICSA-N |
| XLogP | 5.52 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|