C13H19BO2 — CID 177091205
4-(2,2-dimethylpropyl)-2-phenyl-1,3,2-dioxaborolane (PubChem CID 177091205) has the molecular formula C13H19BO2 and a molecular weight of 218.11 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-2-phenyl-1,3,2-dioxaborolane.
| Compound Name | 4-(2,2-dimethylpropyl)-2-phenyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177091205 |
| Molecular Formula | C13H19BO2 |
| Molecular Weight | 218.11 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-2-phenyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)CC1COB(c2ccccc2)O1 |
| InChI | InChI=1S/C13H19BO2/c1-13(2,3)9-12-10-15-14(16-12)11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3 |
| InChIKey | LSXRLUDNEXVNDY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.11 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|