C24H26N4 — CID 177092018
4,7-bis(3,4-dimethyl-2,5-dihydropyrrol-1-yl)-1,10-phenanthroline (PubChem CID 177092018) has the molecular formula C24H26N4 and a molecular weight of 370.50 g/mol. Its IUPAC name is 4,7-bis(3,4-dimethyl-2,5-dihydropyrrol-1-yl)-1,10-phenanthroline.
| Compound Name | 4,7-bis(3,4-dimethyl-2,5-dihydropyrrol-1-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 177092018 |
| Molecular Formula | C24H26N4 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 4,7-bis(3,4-dimethyl-2,5-dihydropyrrol-1-yl)-1,10-phenanthroline |
| SMILES | CC1=C(C)CN(c2ccnc3c2ccc2c(N4CC(C)=C(C)C4)ccnc23)C1 |
| InChI | InChI=1S/C24H26N4/c1-15-11-27(12-16(15)2)21-7-9-25-23-19(21)5-6-20-22(8-10-26-24(20)23)28-13-17(3)18(4)14-28/h5-10H,11-14H2,1-4H3 |
| InChIKey | DTSKCWYVBHDVMX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|