C46H48N4O — CID 177094158
2-[4-[3-tert-butyl-5-(4-prop-1-en-2-yl-2-pyridinyl)phenyl]-1-(3,5-ditert-butylphenyl)benzimidazol-2-yl]-5-isocyanophenol (PubChem CID 177094158) has the molecular formula C46H48N4O and a molecular weight of 672.92 g/mol. Its IUPAC name is 2-[4-[3-tert-butyl-5-(4-prop-1-en-2-yl-2-pyridinyl)phenyl]-1-(3,5-ditert-butylphenyl)benzimidazol-2-yl]-5-isocyanophenol.
| Compound Name | 2-[4-[3-tert-butyl-5-(4-prop-1-en-2-yl-2-pyridinyl)phenyl]-1-(3,5-ditert-butylphenyl)benzimidazol-2-yl]-5-isocyanophenol |
|---|---|
| PubChem CID | 177094158 |
| Molecular Formula | C46H48N4O |
| Molecular Weight | 672.92 g/mol |
| Exact Mass | 672.38 |
| IUPAC Name | 2-[4-[3-tert-butyl-5-(4-prop-1-en-2-yl-2-pyridinyl)phenyl]-1-(3,5-ditert-butylphenyl)benzimidazol-2-yl]-5-isocyanophenol |
| SMILES | [C-]#[N+]c1ccc(-c2nc3c(-c4cc(-c5cc(C(=C)C)ccn5)cc(C(C)(C)C)c4)cccc3n2-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c(O)c1 |
| InChI | InChI=1S/C46H48N4O/c1-28(2)29-18-19-48-39(23-29)31-20-30(21-32(22-31)44(3,4)5)37-14-13-15-40-42(37)49-43(38-17-16-35(47-12)27-41(38)51)50(40)36-25-33(45(6,7)8)24-34(26-36)46(9,10)11/h13-27,51H,1H2,2-11H3 |
| InChIKey | PYJFRYJLIBAKCK-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.92 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|