C23H29N3O2 — CID 177094384
(6aR,9R)-2,3,5-trideuterio-4-propanoyl-N,N-bis(2,2,2-trideuterioethyl)-7-(trideuteriomethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 177094384) has the molecular formula C23H29N3O2 and a molecular weight of 391.58 g/mol. Its IUPAC name is (6aR,9R)-2,3,5-trideuterio-4-propanoyl-N,N-bis(2,2,2-trideuterioethyl)-7-(trideuteriomethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-2,3,5-trideuterio-4-propanoyl-N,N-bis(2,2,2-trideuterioethyl)-7-(trideuteriomethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 177094384 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.30 |
| IUPAC Name | (6aR,9R)-2,3,5-trideuterio-4-propanoyl-N,N-bis(2,2,2-trideuterioethyl)-7-(trideuteriomethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | [2H]c1cc2c3c(c([2H])n(C(=O)CC)c3c1[2H])C[C@@H]1C2=C[C@@H](C(=O)N(CC([2H])([2H])[2H])CC([2H])([2H])[2H])CN1C([2H])([2H])[2H] |
| InChI | InChI=1S/C23H29N3O2/c1-5-21(27)26-14-15-12-20-18(17-9-8-10-19(26)22(15)17)11-16(13-24(20)4)23(28)25(6-2)7-3/h8-11,14,16,20H,5-7,12-13H2,1-4H3/t16-,20-/m1/s1/i2D3,3D3,4D3,8D,10D,14D |
| InChIKey | JSMQOVGXBIDBIE-BZSDDXGCSA-N |
| XLogP | 3.43 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |