C62H52IrN6-2 — CID 177095630
CID 177095630 (PubChem CID 177095630) has the molecular formula C62H52IrN6-2 and a molecular weight of 1078.39 g/mol.
| Compound Name | CID 177095630 |
|---|---|
| PubChem CID | 177095630 |
| Molecular Formula | C62H52IrN6-2 |
| Molecular Weight | 1078.39 g/mol |
| Exact Mass | 1078.42 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]c3c4ccc(C#N)cc4n4c5cc(C#N)ccc5c(c2)c34)nc2ccccc21.[2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])C(C)(C)C)cn2)cc1.[Ir] |
| InChI | InChI=1S/C45H32N5.C17H20N.Ir/c1-26(2)35-20-31(30-10-6-5-7-11-30)21-36(27(3)4)43(35)50-40-13-9-8-12-39(40)48-45(50)32-22-37-33-16-14-28(24-46)18-41(33)49-42-19-29(25-47)15-17-34(42)38(23-32)44(37)49;1-13-5-8-15(9-6-13)16-10-7-14(12-18-16)11-17(2,3)4;/h5-22,26-27H,1-4H3;5-8,10,12H,11H2,1-4H3;/q2*-1;/i;1D3,11D2; |
| InChIKey | WNPDKQLHQIWUFE-JPARUWEZSA-N |
| XLogP | 15.74 |
| TPSA | 82.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1078.39 |
| LogP ≤ 5 | 15.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|