About 2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one
2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one (PubChem CID 177095850) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one |
| PubChem CID | 177095850 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one |
| SMILES | Cc1cc2n(n1)C(=O)N(C(C)C)CC2 |
| InChI | InChI=1S/C10H15N3O/c1-7(2)12-5-4-9-6-8(3)11-13(9)10(12)14/h6-7H,4-5H2,1-3H3 |
| InChIKey | JMGWAFKRBZHJCR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one?
The IUPAC name of 2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one (CID 177095850) is 2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one.
What is the SMILES notation for 2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one?
The canonical SMILES for 2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one is Cc1cc2n(n1)C(=O)N(C(C)C)CC2.
What is the InChIKey of 2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one?
The InChIKey is JMGWAFKRBZHJCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c1-7(2)12-5-4-9-6-8(3)11-13(9)10(12)14/h6-7H,4-5H2,1-3H3.
What are the key properties of 2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one?
2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one has a molecular weight of 193.25 g/mol, XLogP of 1.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-propan-2-yl-4,5-dihydropyrazolo[1,5-c]pyrimidin-7-one is sourced from PubChem (CID 177095850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).