C24H33N10O11P — CID 177096456
[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-propan-2-yloxyoxolan-2-yl]methyl [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] hydrogen phosphate (PubChem CID 177096456) has the molecular formula C24H33N10O11P and a molecular weight of 668.56 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-propan-2-yloxyoxolan-2-yl]methyl [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] hydrogen phosphate.
| Compound Name | [(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-propan-2-yloxyoxolan-2-yl]methyl [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 177096456 |
| Molecular Formula | C24H33N10O11P |
| Molecular Weight | 668.56 g/mol |
| Exact Mass | 668.21 |
| IUPAC Name | [(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-propan-2-yloxyoxolan-2-yl]methyl [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] hydrogen phosphate |
| SMILES | COC1[C@@H](OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(N)nc43)C(O)[C@H]2OC(C)C)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C24H33N10O11P/c1-9(2)42-15-11(44-22(14(15)36)34-8-30-13-20(34)31-24(26)32-21(13)37)5-41-46(38,39)45-16-10(4-35)43-23(17(16)40-3)33-7-29-12-18(25)27-6-28-19(12)33/h6-11,14-17,22-23,35-36H,4-5H2,1-3H3,(H,38,39)(H2,25,27,28)(H3,26,31,32,37)/t10-,11-,14?,15+,16+,17?,22-,23-/m1/s1 |
| InChIKey | ZQFKXMOZOQGXQF-ABMWOVQLSA-N |
| XLogP | -1.42 |
| TPSA | 292.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.56 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|