C33H31N4O5+ — CID 177096768
(2Z)-2-[[3-[(5-carboxy-1,3,3-trimethylindol-1-ium-2-yl)methyl]-2-(1-cyano-2-iminoethenyl)-4-oxocyclobuten-1-yl]methylidene]-1,3,3-trimethylindole-5-carboxylic acid (PubChem CID 177096768) has the molecular formula C33H31N4O5+ and a molecular weight of 563.63 g/mol. Its IUPAC name is (2Z)-2-[[3-[(5-carboxy-1,3,3-trimethylindol-1-ium-2-yl)methyl]-2-(1-cyano-2-iminoethenyl)-4-oxocyclobuten-1-yl]methylidene]-1,3,3-trimethylindole-5-carboxylic acid.
| Compound Name | (2Z)-2-[[3-[(5-carboxy-1,3,3-trimethylindol-1-ium-2-yl)methyl]-2-(1-cyano-2-iminoethenyl)-4-oxocyclobuten-1-yl]methylidene]-1,3,3-trimethylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 177096768 |
| Molecular Formula | C33H31N4O5+ |
| Molecular Weight | 563.63 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | (2Z)-2-[[3-[(5-carboxy-1,3,3-trimethylindol-1-ium-2-yl)methyl]-2-(1-cyano-2-iminoethenyl)-4-oxocyclobuten-1-yl]methylidene]-1,3,3-trimethylindole-5-carboxylic acid |
| SMILES | CN1/C(=C\C2=C(C(=C=N)C#N)C(CC3=[N+](C)c4ccc(C(=O)O)cc4C3(C)C)C2=O)C(C)(C)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C33H30N4O5/c1-32(2)22-11-17(30(39)40)7-9-24(22)36(5)26(32)13-20-28(19(15-34)16-35)21(29(20)38)14-27-33(3,4)23-12-18(31(41)42)8-10-25(23)37(27)6/h7-13,21,34H,14H2,1-6H3,(H-,39,40,41,42)/p+1/b26-13- |
| InChIKey | WDPZUAPHCHVYGC-ZMFRSBBQSA-O |
| XLogP | 4.98 |
| TPSA | 145.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|