About 3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten
3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten (PubChem CID 177097201) has the molecular formula C6H6NO2W-
and a molecular weight of 307.96 g/mol. Its IUPAC name is 3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten.
Molecular Properties
| Compound Name | 3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten |
| PubChem CID | 177097201 |
| Molecular Formula | C6H6NO2W- |
| Molecular Weight | 307.96 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten |
| SMILES | O=C1[N-]C(=O)C2CCC12.[W] |
| InChI | InChI=1S/C6H7NO2.W/c8-5-3-1-2-4(3)6(9)7-5;/h3-4H,1-2H2,(H,7,8,9);/p-1 |
| InChIKey | OMVICUIWNCAVGJ-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.96 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten?
The IUPAC name of 3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten (CID 177097201) is 3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten.
What is the SMILES notation for 3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten?
The canonical SMILES for 3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten is O=C1[N-]C(=O)C2CCC12.[W].
What is the InChIKey of 3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten?
The InChIKey is OMVICUIWNCAVGJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO2.W/c8-5-3-1-2-4(3)6(9)7-5;/h3-4H,1-2H2,(H,7,8,9);/p-1.
What are the key properties of 3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten?
3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten has a molecular weight of 307.96 g/mol, XLogP of 0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azanidabicyclo[3.2.0]heptane-2,4-dione;tungsten is sourced from PubChem (CID 177097201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).