C27H27F3N4O2 — CID 177097829
6-[[[(4S)-3,4-dihydro-2H-chromen-4-yl]amino]methoxymethyl]-N,N,2-trimethyl-3-(2,3,6-trifluorophenyl)pyrazolo[1,5-a]pyridin-7-amine (PubChem CID 177097829) has the molecular formula C27H27F3N4O2 and a molecular weight of 496.53 g/mol. Its IUPAC name is 6-[[[(4S)-3,4-dihydro-2H-chromen-4-yl]amino]methoxymethyl]-N,N,2-trimethyl-3-(2,3,6-trifluorophenyl)pyrazolo[1,5-a]pyridin-7-amine.
| Compound Name | 6-[[[(4S)-3,4-dihydro-2H-chromen-4-yl]amino]methoxymethyl]-N,N,2-trimethyl-3-(2,3,6-trifluorophenyl)pyrazolo[1,5-a]pyridin-7-amine |
|---|---|
| PubChem CID | 177097829 |
| Molecular Formula | C27H27F3N4O2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 6-[[[(4S)-3,4-dihydro-2H-chromen-4-yl]amino]methoxymethyl]-N,N,2-trimethyl-3-(2,3,6-trifluorophenyl)pyrazolo[1,5-a]pyridin-7-amine |
| SMILES | Cc1nn2c(N(C)C)c(COCN[C@H]3CCOc4ccccc43)ccc2c1-c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C27H27F3N4O2/c1-16-24(25-19(28)9-10-20(29)26(25)30)22-11-8-17(27(33(2)3)34(22)32-16)14-35-15-31-21-12-13-36-23-7-5-4-6-18(21)23/h4-11,21,31H,12-15H2,1-3H3/t21-/m0/s1 |
| InChIKey | WHENRKYSFCHTOG-NRFANRHFSA-N |
| XLogP | 5.38 |
| TPSA | 51.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|