C26H28F2N2O2 — CID 177101456
[4-[7-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2,2-difluoro-7-azaspiro[3.5]nonan-6-yl]phenyl] formate (PubChem CID 177101456) has the molecular formula C26H28F2N2O2 and a molecular weight of 438.52 g/mol. Its IUPAC name is [4-[7-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2,2-difluoro-7-azaspiro[3.5]nonan-6-yl]phenyl] formate.
| Compound Name | [4-[7-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2,2-difluoro-7-azaspiro[3.5]nonan-6-yl]phenyl] formate |
|---|---|
| PubChem CID | 177101456 |
| Molecular Formula | C26H28F2N2O2 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | [4-[7-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2,2-difluoro-7-azaspiro[3.5]nonan-6-yl]phenyl] formate |
| SMILES | Cc1cc(C)c2[nH]ccc2c1CN1CCC2(CC1c1ccc(OC=O)cc1)CC(F)(F)C2 |
| InChI | InChI=1S/C26H28F2N2O2/c1-17-11-18(2)24-21(7-9-29-24)22(17)13-30-10-8-25(14-26(27,28)15-25)12-23(30)19-3-5-20(6-4-19)32-16-31/h3-7,9,11,16,23,29H,8,10,12-15H2,1-2H3 |
| InChIKey | QEFRUFHSBHMFER-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|