About 3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide
3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide (PubChem CID 177101518) has the molecular formula C21H20F2N4O
and a molecular weight of 382.41 g/mol. Its IUPAC name is 3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide.
Molecular Properties
| Compound Name | 3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide |
| PubChem CID | 177101518 |
| Molecular Formula | C21H20F2N4O |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1nc2ccccc2nc1N1CCCC(F)(F)CC1 |
| InChI | InChI=1S/C21H20F2N4O/c22-21(23)11-6-13-27(14-12-21)19-18(20(28)24-15-7-2-1-3-8-15)25-16-9-4-5-10-17(16)26-19/h1-5,7-10H,6,11-14H2,(H,24,28) |
| InChIKey | RLRIVBRXCZDBAI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide?
The IUPAC name of 3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide (CID 177101518) is 3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide.
What is the SMILES notation for 3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide?
The canonical SMILES for 3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide is O=C(Nc1ccccc1)c1nc2ccccc2nc1N1CCCC(F)(F)CC1.
What is the InChIKey of 3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide?
The InChIKey is RLRIVBRXCZDBAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F2N4O/c22-21(23)11-6-13-27(14-12-21)19-18(20(28)24-15-7-2-1-3-8-15)25-16-9-4-5-10-17(16)26-19/h1-5,7-10H,6,11-14H2,(H,24,28).
What are the key properties of 3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide?
3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide has a molecular weight of 382.41 g/mol, XLogP of 4.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-difluoroazepan-1-yl)-N-phenylquinoxaline-2-carboxamide is sourced from PubChem (CID 177101518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).