About methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate
methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate (PubChem CID 177101640) has the molecular formula C10H8BrNO3
and a molecular weight of 270.08 g/mol. Its IUPAC name is methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate |
| PubChem CID | 177101640 |
| Molecular Formula | C10H8BrNO3 |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate |
| SMILES | COC(=O)Cc1coc2cnc(Br)cc12 |
| InChI | InChI=1S/C10H8BrNO3/c1-14-10(13)2-6-5-15-8-4-12-9(11)3-7(6)8/h3-5H,2H2,1H3 |
| InChIKey | OVAONTLMHXITJA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate?
The IUPAC name of methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate (CID 177101640) is methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate.
What is the SMILES notation for methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate?
The canonical SMILES for methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate is COC(=O)Cc1coc2cnc(Br)cc12.
What is the InChIKey of methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate?
The InChIKey is OVAONTLMHXITJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrNO3/c1-14-10(13)2-6-5-15-8-4-12-9(11)3-7(6)8/h3-5H,2H2,1H3.
What are the key properties of methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate?
methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate has a molecular weight of 270.08 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-bromofuro[2,3-c]pyridin-3-yl)acetate is sourced from PubChem (CID 177101640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).