C17H24 — CID 177102156
2,2,4,6,6,9-hexamethyltricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene (PubChem CID 177102156) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2,2,4,6,6,9-hexamethyltricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene.
| Compound Name | 2,2,4,6,6,9-hexamethyltricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene |
|---|---|
| PubChem CID | 177102156 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 2,2,4,6,6,9-hexamethyltricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene |
| SMILES | Cc1cc2c3c(c1)C(C)(C)CC3(C)CC2(C)C |
| InChI | InChI=1S/C17H24/c1-11-7-12-14-13(8-11)16(4,5)10-17(14,6)9-15(12,2)3/h7-8H,9-10H2,1-6H3 |
| InChIKey | HXUWSRHSTCQZRI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |