C28H32 — CID 177102314
2,2,5,9,9,16,16-heptamethyltetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3(8),4,6,10,12,14,17,19-nonaene (PubChem CID 177102314) has the molecular formula C28H32 and a molecular weight of 368.56 g/mol. Its IUPAC name is 2,2,5,9,9,16,16-heptamethyltetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3(8),4,6,10,12,14,17,19-nonaene.
| Compound Name | 2,2,5,9,9,16,16-heptamethyltetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3(8),4,6,10,12,14,17,19-nonaene |
|---|---|
| PubChem CID | 177102314 |
| Molecular Formula | C28H32 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 2,2,5,9,9,16,16-heptamethyltetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3(8),4,6,10,12,14,17,19-nonaene |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1ccccc1C(C)(C)c1ccccc1C2(C)C |
| InChI | InChI=1S/C28H32/c1-19-16-17-24-25(18-19)28(6,7)23-15-11-10-14-22(23)26(2,3)20-12-8-9-13-21(20)27(24,4)5/h8-18H,1-7H3 |
| InChIKey | IBVXJGBJRISFQK-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |