C14H9F4O12S3- — CID 177105589
2,3,5,6-tetrafluoro-4-(2-methylsulfonyloxy-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxybenzenesulfonate (PubChem CID 177105589) has the molecular formula C14H9F4O12S3- and a molecular weight of 541.41 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2-methylsulfonyloxy-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2-methylsulfonyloxy-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxybenzenesulfonate |
|---|---|
| PubChem CID | 177105589 |
| Molecular Formula | C14H9F4O12S3- |
| Molecular Weight | 541.41 g/mol |
| Exact Mass | 540.92 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2-methylsulfonyloxy-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxybenzenesulfonate |
| SMILES | CS(=O)(=O)OC1C2OS(=O)(=O)C3C2OC1C3C(=O)Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F |
| InChI | InChI=1S/C14H10F4O12S3/c1-31(20,21)29-9-7-2(12-11(27-7)10(9)30-33(12,25)26)14(19)28-8-3(15)5(17)13(32(22,23)24)6(18)4(8)16/h2,7,9-12H,1H3,(H,22,23,24)/p-1 |
| InChIKey | ZYJONZVPBXAGHI-UHFFFAOYSA-M |
| XLogP | -1.11 |
| TPSA | 179.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.41 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|