C21H38N6O4 — CID 177106667
tert-butyl 4-[5-[1-(oxetan-3-yl)-2,3,3a,4,5,6,7,7a-octahydropyrazolo[4,3-b]pyridin-6-yl]-1,2,4-oxadiazolidin-3-yl]piperidine-1-carboxylate (PubChem CID 177106667) has the molecular formula C21H38N6O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is tert-butyl 4-[5-[1-(oxetan-3-yl)-2,3,3a,4,5,6,7,7a-octahydropyrazolo[4,3-b]pyridin-6-yl]-1,2,4-oxadiazolidin-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[1-(oxetan-3-yl)-2,3,3a,4,5,6,7,7a-octahydropyrazolo[4,3-b]pyridin-6-yl]-1,2,4-oxadiazolidin-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177106667 |
| Molecular Formula | C21H38N6O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | tert-butyl 4-[5-[1-(oxetan-3-yl)-2,3,3a,4,5,6,7,7a-octahydropyrazolo[4,3-b]pyridin-6-yl]-1,2,4-oxadiazolidin-3-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2NOC(C3CNC4CNN(C5COC5)C4C3)N2)CC1 |
| InChI | InChI=1S/C21H38N6O4/c1-21(2,3)30-20(28)26-6-4-13(5-7-26)18-24-19(31-25-18)14-8-17-16(22-9-14)10-23-27(17)15-11-29-12-15/h13-19,22-25H,4-12H2,1-3H3 |
| InChIKey | ICYBYVFIQDBRHN-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |