C30H21BO3 — CID 177108214
(4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid (PubChem CID 177108214) has the molecular formula C30H21BO3 and a molecular weight of 440.31 g/mol. Its IUPAC name is (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid.
| Compound Name | (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid |
|---|---|
| PubChem CID | 177108214 |
| Molecular Formula | C30H21BO3 |
| Molecular Weight | 440.31 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid |
| SMILES | OB(O)c1cc(-c2ccccc2)c(-c2ccc3c(c2)oc2ccccc23)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C30H21BO3/c32-31(33)23-18-26(20-9-3-1-4-10-20)30(27(19-23)21-11-5-2-6-12-21)22-15-16-25-24-13-7-8-14-28(24)34-29(25)17-22/h1-19,32-33H |
| InChIKey | VLGFVVBQUJJYEE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.31 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|