(4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid

C30H21BO3 — CID 177108214

IUPAC(4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid
SMILESOB(O)c1cc(-c2ccccc2)c(-c2ccc3c(c2)oc2ccccc23)c(-c2ccccc2)c1
InChIInChI=1S/C30H21BO3/c32-31(33)23-18-26(20-9-3-1-4-10-20)30(27(19-23)21-11-5-2-6-12-21)22-15-16-25-24-13-7-8-14-28(24)34-29(25)17-22/h1-19,32-33H
InChIKeyVLGFVVBQUJJYEE-UHFFFAOYSA-N
MW440.31 g/mol
LogP6.27
Rot. Bonds4

About (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid

(4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid (PubChem CID 177108214) has the molecular formula C30H21BO3 and a molecular weight of 440.31 g/mol. Its IUPAC name is (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid.

Molecular Properties

Compound Name(4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid
PubChem CID177108214
Molecular FormulaC30H21BO3
Molecular Weight440.31 g/mol
Exact Mass440.16
IUPAC Name(4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid
SMILESOB(O)c1cc(-c2ccccc2)c(-c2ccc3c(c2)oc2ccccc23)c(-c2ccccc2)c1
InChIInChI=1S/C30H21BO3/c32-31(33)23-18-26(20-9-3-1-4-10-20)30(27(19-23)21-11-5-2-6-12-21)22-15-16-25-24-13-7-8-14-28(24)34-29(25)17-22/h1-19,32-33H
InChIKeyVLGFVVBQUJJYEE-UHFFFAOYSA-N
XLogP6.27
TPSA53.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms34
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500440.31
LogP ≤ 56.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid?
The IUPAC name of (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid (CID 177108214) is (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid.
What is the SMILES notation for (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid?
The canonical SMILES for (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid is OB(O)c1cc(-c2ccccc2)c(-c2ccc3c(c2)oc2ccccc23)c(-c2ccccc2)c1.
What is the InChIKey of (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid?
The InChIKey is VLGFVVBQUJJYEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H21BO3/c32-31(33)23-18-26(20-9-3-1-4-10-20)30(27(19-23)21-11-5-2-6-12-21)22-15-16-25-24-13-7-8-14-28(24)34-29(25)17-22/h1-19,32-33H.
What are the key properties of (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid?
(4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid has a molecular weight of 440.31 g/mol, XLogP of 6.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-dibenzofuran-3-yl-3,5-diphenylphenyl)boronic acid is sourced from PubChem (CID 177108214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).