About 2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol
2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol (PubChem CID 177110674) has the molecular formula C29H17F3N2O2
and a molecular weight of 482.46 g/mol. Its IUPAC name is 2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol |
| PubChem CID | 177110674 |
| Molecular Formula | C29H17F3N2O2 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nc2c(-c3cccc(-c4cc(C(F)(F)F)cc5cccnc45)c3)cccc2o1 |
| InChI | InChI=1S/C29H17F3N2O2/c30-29(31,32)20-15-19-8-5-13-33-26(19)23(16-20)18-7-3-6-17(14-18)21-10-4-12-25-27(21)34-28(36-25)22-9-1-2-11-24(22)35/h1-16,35H |
| InChIKey | CAYVJQAOZLMIJN-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol?
The IUPAC name of 2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol (CID 177110674) is 2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol.
What is the SMILES notation for 2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol?
The canonical SMILES for 2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol is Oc1ccccc1-c1nc2c(-c3cccc(-c4cc(C(F)(F)F)cc5cccnc45)c3)cccc2o1.
What is the InChIKey of 2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol?
The InChIKey is CAYVJQAOZLMIJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H17F3N2O2/c30-29(31,32)20-15-19-8-5-13-33-26(19)23(16-20)18-7-3-6-17(14-18)21-10-4-12-25-27(21)34-28(36-25)22-9-1-2-11-24(22)35/h1-16,35H.
What are the key properties of 2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol?
2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol has a molecular weight of 482.46 g/mol, XLogP of 8.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]phenyl]-1,3-benzoxazol-2-yl]phenol is sourced from PubChem (CID 177110674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).