C24H33FO7S — CID 177111099
3-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxypropane-1-sulfonic acid (PubChem CID 177111099) has the molecular formula C24H33FO7S and a molecular weight of 484.59 g/mol. Its IUPAC name is 3-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxypropane-1-sulfonic acid.
| Compound Name | 3-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 177111099 |
| Molecular Formula | C24H33FO7S |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 3-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxypropane-1-sulfonic acid |
| SMILES | CC(C)C(Oc1cc(C(=O)OCCCS(=O)(=O)O)ccc1F)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C24H33FO7S/c1-14(2)24(31-21-13-16-11-19(21)18-6-3-5-17(16)18)32-22-12-15(7-8-20(22)25)23(26)30-9-4-10-33(27,28)29/h7-8,12,14,16-19,21,24H,3-6,9-11,13H2,1-2H3,(H,27,28,29) |
| InChIKey | BYIUXXBEEAKYFZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|