C23H31FO7S — CID 177111617
2-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxyethanesulfonic acid (PubChem CID 177111617) has the molecular formula C23H31FO7S and a molecular weight of 470.56 g/mol. Its IUPAC name is 2-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 177111617 |
| Molecular Formula | C23H31FO7S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 2-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxyethanesulfonic acid |
| SMILES | CC(C)C(Oc1cc(C(=O)OCCS(=O)(=O)O)ccc1F)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C23H31FO7S/c1-13(2)23(30-20-12-15-10-18(20)17-5-3-4-16(15)17)31-21-11-14(6-7-19(21)24)22(25)29-8-9-32(26,27)28/h6-7,11,13,15-18,20,23H,3-5,8-10,12H2,1-2H3,(H,26,27,28) |
| InChIKey | JYVVKPJEEDCWED-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|