C28H31F3O4 — CID 177111853
phenyl 3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-4-(trifluoromethyl)benzoate (PubChem CID 177111853) has the molecular formula C28H31F3O4 and a molecular weight of 488.55 g/mol. Its IUPAC name is phenyl 3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-4-(trifluoromethyl)benzoate.
| Compound Name | phenyl 3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 177111853 |
| Molecular Formula | C28H31F3O4 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | phenyl 3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-4-(trifluoromethyl)benzoate |
| SMILES | CC(C)C(Oc1cc(C(=O)Oc2ccccc2)ccc1C(F)(F)F)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C28H31F3O4/c1-16(2)27(34-24-15-18-13-22(24)21-10-6-9-20(18)21)35-25-14-17(11-12-23(25)28(29,30)31)26(32)33-19-7-4-3-5-8-19/h3-5,7-8,11-12,14,16,18,20-22,24,27H,6,9-10,13,15H2,1-2H3 |
| InChIKey | BMHLCTHYNWSGHC-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|